C24H28N4O3S2 — CID 4850339
2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)propanamide (PubChem CID 4850339) has the molecular formula C24H28N4O3S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 4850339 |
| Molecular Formula | C24H28N4O3S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)Sc1nc2sc3c(c2c(=O)n1-c1ccc(C)cc1C)CCCC3 |
| InChI | InChI=1S/C24H28N4O3S2/c1-5-25-23(31)26-20(29)15(4)32-24-27-21-19(16-8-6-7-9-18(16)33-21)22(30)28(24)17-11-10-13(2)12-14(17)3/h10-12,15H,5-9H2,1-4H3,(H2,25,26,29,31) |
| InChIKey | SLUJWZAZZFEYHZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |