C23H27N3O2S2 — CID 60602077
2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N,N-dimethylpropanamide (PubChem CID 60602077) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N,N-dimethylpropanamide.
| Compound Name | 2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60602077 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[[3-(2,4-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N,N-dimethylpropanamide |
| SMILES | Cc1ccc(-n2c(SC(C)C(=O)N(C)C)nc3sc4c(c3c2=O)CCCC4)c(C)c1 |
| InChI | InChI=1S/C23H27N3O2S2/c1-13-10-11-17(14(2)12-13)26-22(28)19-16-8-6-7-9-18(16)30-20(19)24-23(26)29-15(3)21(27)25(4)5/h10-12,15H,6-9H2,1-5H3 |
| InChIKey | NIWDBDSILRHRLV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |