C24H27N3O4S2 — CID 2491272
methyl 2-[[2-[[4-(2,4-dimethylphenyl)-3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl]sulfanyl]acetyl]amino]acetate (PubChem CID 2491272) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is methyl 2-[[2-[[4-(2,4-dimethylphenyl)-3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl]sulfanyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[4-(2,4-dimethylphenyl)-3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl]sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 2491272 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | methyl 2-[[2-[[4-(2,4-dimethylphenyl)-3-oxo-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-5-yl]sulfanyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CSc1nc2sc3c(c2c(=O)n1-c1ccc(C)cc1C)CCCCC3 |
| InChI | InChI=1S/C24H27N3O4S2/c1-14-9-10-17(15(2)11-14)27-23(30)21-16-7-5-4-6-8-18(16)33-22(21)26-24(27)32-13-19(28)25-12-20(29)31-3/h9-11H,4-8,12-13H2,1-3H3,(H,25,28) |
| InChIKey | ZNKIETYKYGPVHA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |