C25H25N3O2S3 — CID 4566219
2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4566219) has the molecular formula C25H25N3O2S3 and a molecular weight of 495.70 g/mol. Its IUPAC name is 2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4566219 |
| Molecular Formula | C25H25N3O2S3 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | Cc1ccc(C)c(-n2c(SCC(=O)NCc3cccs3)nc3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C25H25N3O2S3/c1-15-9-10-16(2)19(12-15)28-24(30)22-18-7-3-4-8-20(18)33-23(22)27-25(28)32-14-21(29)26-13-17-6-5-11-31-17/h5-6,9-12H,3-4,7-8,13-14H2,1-2H3,(H,26,29) |
| InChIKey | PMTKKBQFPOWWFH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |