C23H26N4O3S2 — CID 3923442
2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide (PubChem CID 3923442) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 3923442 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[[3-(2,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CSc1nc2sc3c(c2c(=O)n1-c1cc(C)ccc1C)CCCC3 |
| InChI | InChI=1S/C23H26N4O3S2/c1-4-24-22(30)25-18(28)12-31-23-26-20-19(15-7-5-6-8-17(15)32-20)21(29)27(23)16-11-13(2)9-10-14(16)3/h9-11H,4-8,12H2,1-3H3,(H2,24,25,28,30) |
| InChIKey | YZVLBDKTUJOARY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |