C23H27N3O2S2 — CID 55418522
2-[[11-(2,4-dimethylphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-propylpropanamide (PubChem CID 55418522) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[[11-(2,4-dimethylphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-propylpropanamide.
| Compound Name | 2-[[11-(2,4-dimethylphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-propylpropanamide |
|---|---|
| PubChem CID | 55418522 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[[11-(2,4-dimethylphenyl)-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Sc1nc2sc3c(c2c(=O)n1-c1ccc(C)cc1C)CCC3 |
| InChI | InChI=1S/C23H27N3O2S2/c1-5-11-24-20(27)15(4)29-23-25-21-19(16-7-6-8-18(16)30-21)22(28)26(23)17-10-9-13(2)12-14(17)3/h9-10,12,15H,5-8,11H2,1-4H3,(H,24,27) |
| InChIKey | MJLNQPYDYDNEBX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |