C22H18N4O2S3 — CID 24558384
2-[[5-(5-methylthiophen-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 24558384) has the molecular formula C22H18N4O2S3 and a molecular weight of 466.61 g/mol. Its IUPAC name is 2-[[5-(5-methylthiophen-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 2-[[5-(5-methylthiophen-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 24558384 |
| Molecular Formula | C22H18N4O2S3 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 2-[[5-(5-methylthiophen-2-yl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | Cc1ccc(-c2csc3ncn(Cc4cc(=O)n5c6c(sc5n4)CCCC6)c(=O)c23)s1 |
| InChI | InChI=1S/C22H18N4O2S3/c1-12-6-7-16(30-12)14-10-29-20-19(14)21(28)25(11-23-20)9-13-8-18(27)26-15-4-2-3-5-17(15)31-22(26)24-13/h6-8,10-11H,2-5,9H2,1H3 |
| InChIKey | UZFCIOYWJBACLT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |