C18H16N4O2S2 — CID 24576659
3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 24576659) has the molecular formula C18H16N4O2S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is 3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24576659 |
| Molecular Formula | C18H16N4O2S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1csc2nc(Cn3cnc4sc5c(c4c3=O)CCCC5)cc(=O)n12 |
| InChI | InChI=1S/C18H16N4O2S2/c1-10-8-25-18-20-11(6-14(23)22(10)18)7-21-9-19-16-15(17(21)24)12-4-2-3-5-13(12)26-16/h6,8-9H,2-5,7H2,1H3 |
| InChIKey | YFKWWLMLWZZVAZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'} |
|---|