C23H19N3O2 — CID 24559782
N'-[2-(1H-indol-3-yl)acetyl]-1,2-dihydroacenaphthylene-5-carbohydrazide (PubChem CID 24559782) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-1,2-dihydroacenaphthylene-5-carbohydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-1,2-dihydroacenaphthylene-5-carbohydrazide |
|---|---|
| PubChem CID | 24559782 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-1,2-dihydroacenaphthylene-5-carbohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C23H19N3O2/c27-21(12-16-13-24-20-7-2-1-5-17(16)20)25-26-23(28)19-11-10-15-9-8-14-4-3-6-18(19)22(14)15/h1-7,10-11,13,24H,8-9,12H2,(H,25,27)(H,26,28) |
| InChIKey | MZJPMKUDWRUPNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|