C14H11F3N4S — CID 24562217
1-(difluoromethyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanylmethyl]imidazole (PubChem CID 24562217) has the molecular formula C14H11F3N4S and a molecular weight of 324.33 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanylmethyl]imidazole.
| Compound Name | 1-(difluoromethyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanylmethyl]imidazole |
|---|---|
| PubChem CID | 24562217 |
| Molecular Formula | C14H11F3N4S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(difluoromethyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanylmethyl]imidazole |
| SMILES | Fc1ccc(-c2cnc(SCc3nccn3C(F)F)[nH]2)cc1 |
| InChI | InChI=1S/C14H11F3N4S/c15-10-3-1-9(2-4-10)11-7-19-14(20-11)22-8-12-18-5-6-21(12)13(16)17/h1-7,13H,8H2,(H,19,20) |
| InChIKey | LTBLRDHGWDXARX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |