C12H13F2N3S — CID 79142305
2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-4-methylaniline (PubChem CID 79142305) has the molecular formula C12H13F2N3S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-4-methylaniline.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-4-methylaniline |
|---|---|
| PubChem CID | 79142305 |
| Molecular Formula | C12H13F2N3S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-4-methylaniline |
| SMILES | Cc1ccc(N)c(SCc2nccn2C(F)F)c1 |
| InChI | InChI=1S/C12H13F2N3S/c1-8-2-3-9(15)10(6-8)18-7-11-16-4-5-17(11)12(13)14/h2-6,12H,7,15H2,1H3 |
| InChIKey | MWQQBZFNHAXJSX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|