C9H11F2NS — CID 79142218
2-(2,2-difluoroethylsulfanyl)-4-methylaniline (PubChem CID 79142218) has the molecular formula C9H11F2NS and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethylsulfanyl)-4-methylaniline.
| Compound Name | 2-(2,2-difluoroethylsulfanyl)-4-methylaniline |
|---|---|
| PubChem CID | 79142218 |
| Molecular Formula | C9H11F2NS |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-(2,2-difluoroethylsulfanyl)-4-methylaniline |
| SMILES | Cc1ccc(N)c(SCC(F)F)c1 |
| InChI | InChI=1S/C9H11F2NS/c1-6-2-3-7(12)8(4-6)13-5-9(10)11/h2-4,9H,5,12H2,1H3 |
| InChIKey | ODRBLLJBQJAHHO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|