C14H13F2NS — CID 79142132
2-[(2,3-difluorophenyl)methylsulfanyl]-4-methylaniline (PubChem CID 79142132) has the molecular formula C14H13F2NS and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]-4-methylaniline.
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-4-methylaniline |
|---|---|
| PubChem CID | 79142132 |
| Molecular Formula | C14H13F2NS |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-4-methylaniline |
| SMILES | Cc1ccc(N)c(SCc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C14H13F2NS/c1-9-5-6-12(17)13(7-9)18-8-10-3-2-4-11(15)14(10)16/h2-7H,8,17H2,1H3 |
| InChIKey | ZZIPIIFYGWWGJQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|