C16H17NO2S — CID 79142191
3-(2-amino-5-methylphenyl)sulfanyl-2-phenylpropanoic acid (PubChem CID 79142191) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-(2-amino-5-methylphenyl)sulfanyl-2-phenylpropanoic acid.
| Compound Name | 3-(2-amino-5-methylphenyl)sulfanyl-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 79142191 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-(2-amino-5-methylphenyl)sulfanyl-2-phenylpropanoic acid |
| SMILES | Cc1ccc(N)c(SCC(C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H17NO2S/c1-11-7-8-14(17)15(9-11)20-10-13(16(18)19)12-5-3-2-4-6-12/h2-9,13H,10,17H2,1H3,(H,18,19) |
| InChIKey | SEAORXFHSMAIHO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|