C23H24F3N5O3 — CID 24563683
3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide (PubChem CID 24563683) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide.
| Compound Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide |
|---|---|
| PubChem CID | 24563683 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpropanamide |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)Nc1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C23H24F3N5O3/c1-13-16(14(2)31-21(27-13)29-20(30-31)23(24,25)26)7-9-19(32)28-15-6-8-17-18(12-15)34-22(33-17)10-4-3-5-11-22/h6,8,12H,3-5,7,9-11H2,1-2H3,(H,28,32) |
| InChIKey | NEEQPHDHLCPYFA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |