C19H16F5N5O3 — CID 27030393
[2-(3,4-difluoroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate (PubChem CID 27030393) has the molecular formula C19H16F5N5O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate |
|---|---|
| PubChem CID | 27030393 |
| Molecular Formula | C19H16F5N5O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoate |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)OCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H16F5N5O3/c1-9-12(10(2)29-18(25-9)27-17(28-29)19(22,23)24)4-6-16(31)32-8-15(30)26-11-3-5-13(20)14(21)7-11/h3,5,7H,4,6,8H2,1-2H3,(H,26,30) |
| InChIKey | JIVPIAHLPYGJTJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |