C20H24N6O3 — CID 4855252
[2-(3,4-dimethylanilino)-2-oxoethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 4855252) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is [2-(3,4-dimethylanilino)-2-oxoethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 4855252 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [2-(3,4-dimethylanilino)-2-oxoethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCc2c(C)nc3nc(N)nn3c2C)cc1C |
| InChI | InChI=1S/C20H24N6O3/c1-11-5-6-15(9-12(11)2)23-17(27)10-29-18(28)8-7-16-13(3)22-20-24-19(21)25-26(20)14(16)4/h5-6,9H,7-8,10H2,1-4H3,(H2,21,25)(H,23,27) |
| InChIKey | PIEPQXGGMCOIDV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |