C16H17BrN2O3S — CID 24565660
methyl 3-[[2-[(2-bromophenyl)methyl-methylamino]acetyl]amino]thiophene-2-carboxylate (PubChem CID 24565660) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is methyl 3-[[2-[(2-bromophenyl)methyl-methylamino]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[(2-bromophenyl)methyl-methylamino]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24565660 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | methyl 3-[[2-[(2-bromophenyl)methyl-methylamino]acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CN(C)Cc1ccccc1Br |
| InChI | InChI=1S/C16H17BrN2O3S/c1-19(9-11-5-3-4-6-12(11)17)10-14(20)18-13-7-8-23-15(13)16(21)22-2/h3-8H,9-10H2,1-2H3,(H,18,20) |
| InChIKey | QQBMOJZQSYURJO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |