C24H25N5O2S2 — CID 24567254
N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide (PubChem CID 24567254) has the molecular formula C24H25N5O2S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 24567254 |
| Molecular Formula | C24H25N5O2S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCC(=O)NCCSCc3ccc(C)cc3)nnc12 |
| InChI | InChI=1S/C24H25N5O2S2/c1-3-13-28-22(31)19-6-4-5-7-20(19)29-23(28)26-27-24(29)33-16-21(30)25-12-14-32-15-18-10-8-17(2)9-11-18/h3-11H,1,12-16H2,2H3,(H,25,30) |
| InChIKey | FOCFSTWNLBZZRU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|