C24H23FN6O3S — CID 24668525
3-fluoro-4-methyl-N-[2-[[2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetyl]amino]ethyl]benzamide (PubChem CID 24668525) has the molecular formula C24H23FN6O3S and a molecular weight of 494.55 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 24668525 |
| Molecular Formula | C24H23FN6O3S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[2-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetyl]amino]ethyl]benzamide |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCC(=O)NCCNC(=O)c3ccc(C)c(F)c3)nnc12 |
| InChI | InChI=1S/C24H23FN6O3S/c1-3-12-30-22(34)17-6-4-5-7-19(17)31-23(30)28-29-24(31)35-14-20(32)26-10-11-27-21(33)16-9-8-15(2)18(25)13-16/h3-9,13H,1,10-12,14H2,2H3,(H,26,32)(H,27,33) |
| InChIKey | GJIASSMWDKGSGZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 110.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|