C23H20N2O5S — CID 24569617
ethyl (E)-3-[4-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]phenyl]prop-2-enoate (PubChem CID 24569617) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24569617 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | ethyl (E)-3-[4-[[2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)cc1 |
| InChI | InChI=1S/C23H20N2O5S/c1-2-30-22(27)14-11-16-9-12-18(13-10-16)24-21(26)15-25-19-7-3-5-17-6-4-8-20(23(17)19)31(25,28)29/h3-14H,2,15H2,1H3,(H,24,26)/b14-11+ |
| InChIKey | RZHWXQMXNYFDTR-SDNWHVSQSA-N |
| XLogP | 3.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|