C21H19N3O4S — CID 39412711
N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide (PubChem CID 39412711) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide.
| Compound Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
|---|---|
| PubChem CID | 39412711 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)CN2c3cccc4cccc(c34)S2(=O)=O)cc1C |
| InChI | InChI=1S/C21H19N3O4S/c1-13-9-10-16(11-14(13)2)22-21(26)23-19(25)12-24-17-7-3-5-15-6-4-8-18(20(15)17)29(24,27)28/h3-11H,12H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | VAUZHGCSKUFBDF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |