C20H23N3O4S — CID 8020813
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide (PubChem CID 8020813) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 8020813 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[[(1R,2S)-2-methylcyclohexyl]carbamoyl]acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)NC(=O)CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C20H23N3O4S/c1-13-6-2-3-9-15(13)21-20(25)22-18(24)12-23-16-10-4-7-14-8-5-11-17(19(14)16)28(23,26)27/h4-5,7-8,10-11,13,15H,2-3,6,9,12H2,1H3,(H2,21,22,24,25)/t13-,15+/m0/s1 |
| InChIKey | DDXBLFMBTNQLMC-DZGCQCFKSA-N |
| XLogP | 2.75 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |