C23H22N2O4S — CID 30806938
N-(3-cyclopentyloxyphenyl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide (PubChem CID 30806938) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(3-cyclopentyloxyphenyl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide.
| Compound Name | N-(3-cyclopentyloxyphenyl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
|---|---|
| PubChem CID | 30806938 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-(3-cyclopentyloxyphenyl)-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)acetamide |
| SMILES | O=C(CN1c2cccc3cccc(c23)S1(=O)=O)Nc1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C23H22N2O4S/c26-22(24-17-8-5-11-19(14-17)29-18-9-1-2-10-18)15-25-20-12-3-6-16-7-4-13-21(23(16)20)30(25,27)28/h3-8,11-14,18H,1-2,9-10,15H2,(H,24,26) |
| InChIKey | VINHTEXCLALMRB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |