C24H17FN2O4S — CID 52725320
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[2-(3-fluorophenoxy)phenyl]acetamide (PubChem CID 52725320) has the molecular formula C24H17FN2O4S and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[2-(3-fluorophenoxy)phenyl]acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[2-(3-fluorophenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 52725320 |
| Molecular Formula | C24H17FN2O4S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[2-(3-fluorophenoxy)phenyl]acetamide |
| SMILES | O=C(CN1c2cccc3cccc(c23)S1(=O)=O)Nc1ccccc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C24H17FN2O4S/c25-17-8-5-9-18(14-17)31-21-12-2-1-10-19(21)26-23(28)15-27-20-11-3-6-16-7-4-13-22(24(16)20)32(27,29)30/h1-14H,15H2,(H,26,28) |
| InChIKey | FSVYCIPTPPARAT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |