C23H21N3O4S — CID 30875148
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]acetamide (PubChem CID 30875148) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 30875148 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]acetamide |
| SMILES | O=C(CN1c2cccc3cccc(c23)S1(=O)=O)Nc1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C23H21N3O4S/c27-21(24-18-8-1-5-16(13-18)14-25-12-4-11-22(25)28)15-26-19-9-2-6-17-7-3-10-20(23(17)19)31(26,29)30/h1-3,5-10,13H,4,11-12,14-15H2,(H,24,27) |
| InChIKey | WOABYWKOEIJARO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |