C27H25N5O3S — CID 24571353
2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 24571353) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24571353 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H25N5O3S/c33-24(31-17-15-30(16-18-31)22-13-7-8-14-23(22)32(34)35)19-36-27-28-25(20-9-3-1-4-10-20)26(29-27)21-11-5-2-6-12-21/h1-14H,15-19H2,(H,28,29) |
| InChIKey | YNVHNMODLVJFST-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|