C28H29N3O3S — CID 24574661
2-(2-benzhydryloxyethylsulfanyl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide (PubChem CID 24574661) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-(2-benzhydryloxyethylsulfanyl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide.
| Compound Name | 2-(2-benzhydryloxyethylsulfanyl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 24574661 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-(2-benzhydryloxyethylsulfanyl)-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)acetamide |
| SMILES | Cc1c(NC(=O)CSCCOC(c2ccccc2)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H29N3O3S/c1-21-26(28(33)31(30(21)2)24-16-10-5-11-17-24)29-25(32)20-35-19-18-34-27(22-12-6-3-7-13-22)23-14-8-4-9-15-23/h3-17,27H,18-20H2,1-2H3,(H,29,32) |
| InChIKey | MVUJKQCFABGJEJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|