C25H27NO2S — CID 22830724
2-(2-benzhydryloxyethylsulfanyl)-N-(2,5-dimethylphenyl)acetamide (PubChem CID 22830724) has the molecular formula C25H27NO2S and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-(2-benzhydryloxyethylsulfanyl)-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(2-benzhydryloxyethylsulfanyl)-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 22830724 |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-(2-benzhydryloxyethylsulfanyl)-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CSCCOC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H27NO2S/c1-19-13-14-20(2)23(17-19)26-24(27)18-29-16-15-28-25(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-14,17,25H,15-16,18H2,1-2H3,(H,26,27) |
| InChIKey | GINXFVDGDAQFRA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|