C24H32N2O4 — CID 24574965
2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-N-(3-phenylmethoxypropyl)acetamide (PubChem CID 24574965) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-N-(3-phenylmethoxypropyl)acetamide.
| Compound Name | 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-N-(3-phenylmethoxypropyl)acetamide |
|---|---|
| PubChem CID | 24574965 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-N-(3-phenylmethoxypropyl)acetamide |
| SMILES | COc1ccc(C2CCCN2CC(=O)NCCCOCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H32N2O4/c1-28-20-11-12-21(23(16-20)29-2)22-10-6-14-26(22)17-24(27)25-13-7-15-30-18-19-8-4-3-5-9-19/h3-5,8-9,11-12,16,22H,6-7,10,13-15,17-18H2,1-2H3,(H,25,27) |
| InChIKey | MAWZWDMMTKEUCV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|