C22H21N3O3 — CID 2457579
2-(2-phenoxyethoxy)-N'-(1-pyridin-2-ylethenyl)benzohydrazide (PubChem CID 2457579) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)-N'-(1-pyridin-2-ylethenyl)benzohydrazide.
| Compound Name | 2-(2-phenoxyethoxy)-N'-(1-pyridin-2-ylethenyl)benzohydrazide |
|---|---|
| PubChem CID | 2457579 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(2-phenoxyethoxy)-N'-(1-pyridin-2-ylethenyl)benzohydrazide |
| SMILES | C=C(NNC(=O)c1ccccc1OCCOc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C22H21N3O3/c1-17(20-12-7-8-14-23-20)24-25-22(26)19-11-5-6-13-21(19)28-16-15-27-18-9-3-2-4-10-18/h2-14,24H,1,15-16H2,(H,25,26) |
| InChIKey | LBZROUVSLFTMSJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|