C26H27N3O5 — CID 4954512
2-methyl-N-[4-[[[2-(2-phenoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide (PubChem CID 4954512) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-methyl-N-[4-[[[2-(2-phenoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[[2-(2-phenoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 4954512 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-methyl-N-[4-[[[2-(2-phenoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NNC(=O)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-18(2)24(30)27-20-14-12-19(13-15-20)25(31)28-29-26(32)22-10-6-7-11-23(22)34-17-16-33-21-8-4-3-5-9-21/h3-15,18H,16-17H2,1-2H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | RRTDMNGDSRYDDR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|