C22H21BrN2O3 — CID 24576886
quinolin-8-ylmethyl (2S)-2-[(2-bromobenzoyl)amino]-3-methylbutanoate (PubChem CID 24576886) has the molecular formula C22H21BrN2O3 and a molecular weight of 441.33 g/mol. Its IUPAC name is quinolin-8-ylmethyl (2S)-2-[(2-bromobenzoyl)amino]-3-methylbutanoate.
| Compound Name | quinolin-8-ylmethyl (2S)-2-[(2-bromobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 24576886 |
| Molecular Formula | C22H21BrN2O3 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | quinolin-8-ylmethyl (2S)-2-[(2-bromobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1Br)C(=O)OCc1cccc2cccnc12 |
| InChI | InChI=1S/C22H21BrN2O3/c1-14(2)19(25-21(26)17-10-3-4-11-18(17)23)22(27)28-13-16-8-5-7-15-9-6-12-24-20(15)16/h3-12,14,19H,13H2,1-2H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | ZIGOTGUQAOZLHP-IBGZPJMESA-N |
| XLogP | 4.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |