C26H26ClN3O4 — CID 24578731
5-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-N-phenylbenzamide (PubChem CID 24578731) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 5-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-N-phenylbenzamide.
| Compound Name | 5-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 24578731 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 5-chloro-2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-N-phenylbenzamide |
| SMILES | COc1ccc(N2CCN(C(=O)COc3ccc(Cl)cc3C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H26ClN3O4/c1-33-22-10-8-21(9-11-22)29-13-15-30(16-14-29)25(31)18-34-24-12-7-19(27)17-23(24)26(32)28-20-5-3-2-4-6-20/h2-12,17H,13-16,18H2,1H3,(H,28,32) |
| InChIKey | DBLHIUPSHLVDHK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|