C20H18F2N2O2S — CID 24579298
2-cyclopropyl-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]quinazoline (PubChem CID 24579298) has the molecular formula C20H18F2N2O2S and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-cyclopropyl-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]quinazoline.
| Compound Name | 2-cyclopropyl-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]quinazoline |
|---|---|
| PubChem CID | 24579298 |
| Molecular Formula | C20H18F2N2O2S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-cyclopropyl-4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]quinazoline |
| SMILES | COc1cc(CSc2nc(C3CC3)nc3ccccc23)ccc1OC(F)F |
| InChI | InChI=1S/C20H18F2N2O2S/c1-25-17-10-12(6-9-16(17)26-20(21)22)11-27-19-14-4-2-3-5-15(14)23-18(24-19)13-7-8-13/h2-6,9-10,13,20H,7-8,11H2,1H3 |
| InChIKey | CMAUOUBUYGLXCG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |