C13H13F2N3O2S — CID 106679000
3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]pyrazin-2-amine (PubChem CID 106679000) has the molecular formula C13H13F2N3O2S and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]pyrazin-2-amine.
| Compound Name | 3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 106679000 |
| Molecular Formula | C13H13F2N3O2S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfanyl]pyrazin-2-amine |
| SMILES | COc1cc(CSc2nccnc2N)ccc1OC(F)F |
| InChI | InChI=1S/C13H13F2N3O2S/c1-19-10-6-8(2-3-9(10)20-13(14)15)7-21-12-11(16)17-4-5-18-12/h2-6,13H,7H2,1H3,(H2,16,17) |
| InChIKey | AXNMKPIBDUQSDA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |