C24H25N5O2S — CID 24579377
4-[2-(2-cyclopropylquinazolin-4-yl)sulfanylacetyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 24579377) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-[2-(2-cyclopropylquinazolin-4-yl)sulfanylacetyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(2-cyclopropylquinazolin-4-yl)sulfanylacetyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 24579377 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-[2-(2-cyclopropylquinazolin-4-yl)sulfanylacetyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | O=C(CSc1nc(C2CC2)nc2ccccc12)N1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C24H25N5O2S/c30-21(28-12-14-29(15-13-28)24(31)25-18-6-2-1-3-7-18)16-32-23-19-8-4-5-9-20(19)26-22(27-23)17-10-11-17/h1-9,17H,10-16H2,(H,25,31) |
| InChIKey | VOYJTKFJQRKYFN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |