C25H28N4OS — CID 24579297
2-(2-cyclopropylquinazolin-4-yl)sulfanyl-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone (PubChem CID 24579297) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-(2-cyclopropylquinazolin-4-yl)sulfanyl-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-cyclopropylquinazolin-4-yl)sulfanyl-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24579297 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-(2-cyclopropylquinazolin-4-yl)sulfanyl-1-[4-(1-phenylethyl)piperazin-1-yl]ethanone |
| SMILES | CC(c1ccccc1)N1CCN(C(=O)CSc2nc(C3CC3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C25H28N4OS/c1-18(19-7-3-2-4-8-19)28-13-15-29(16-14-28)23(30)17-31-25-21-9-5-6-10-22(21)26-24(27-25)20-11-12-20/h2-10,18,20H,11-17H2,1H3 |
| InChIKey | FPZIOOVUKYBVGD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |