C20H24N4O2S2 — CID 24579600
N-(3-phenylmethoxypropyl)-2-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 24579600) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(3-phenylmethoxypropyl)-2-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-phenylmethoxypropyl)-2-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 24579600 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-(3-phenylmethoxypropyl)-2-[[4-(2-thiophen-2-ylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nncn1CCc1cccs1)NCCCOCc1ccccc1 |
| InChI | InChI=1S/C20H24N4O2S2/c25-19(21-10-5-12-26-14-17-6-2-1-3-7-17)15-28-20-23-22-16-24(20)11-9-18-8-4-13-27-18/h1-4,6-8,13,16H,5,9-12,14-15H2,(H,21,25) |
| InChIKey | UFLSJANXORYBLM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|