C18H15BrF3N5O2 — CID 24580419
(4-bromophenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate (PubChem CID 24580419) has the molecular formula C18H15BrF3N5O2 and a molecular weight of 470.25 g/mol. Its IUPAC name is (4-bromophenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate.
| Compound Name | (4-bromophenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 24580419 |
| Molecular Formula | C18H15BrF3N5O2 |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (4-bromophenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1)C1CCN(c2ccc3nnc(C(F)(F)F)n3n2)CC1 |
| InChI | InChI=1S/C18H15BrF3N5O2/c19-12-1-3-13(4-2-12)29-16(28)11-7-9-26(10-8-11)15-6-5-14-23-24-17(18(20,21)22)27(14)25-15/h1-6,11H,7-10H2 |
| InChIKey | KMGFBYJCWCDASI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|