C21H22F3N5O3 — CID 24581374
(2-propoxyphenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate (PubChem CID 24581374) has the molecular formula C21H22F3N5O3 and a molecular weight of 449.43 g/mol. Its IUPAC name is (2-propoxyphenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate.
| Compound Name | (2-propoxyphenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 24581374 |
| Molecular Formula | C21H22F3N5O3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (2-propoxyphenyl) 1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxylate |
| SMILES | CCCOc1ccccc1OC(=O)C1CCN(c2ccc3nnc(C(F)(F)F)n3n2)CC1 |
| InChI | InChI=1S/C21H22F3N5O3/c1-2-13-31-15-5-3-4-6-16(15)32-19(30)14-9-11-28(12-10-14)18-8-7-17-25-26-20(21(22,23)24)29(17)27-18/h3-8,14H,2,9-13H2,1H3 |
| InChIKey | UKXIBJQVQLACOZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|