C16H20N4O4 — CID 24582125
3-[[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetyl]amino]-N-methylbenzamide (PubChem CID 24582125) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 24582125 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CN2C(=O)NC(C(C)C)C2=O)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-9(2)13-15(23)20(16(24)19-13)8-12(21)18-11-6-4-5-10(7-11)14(22)17-3/h4-7,9,13H,8H2,1-3H3,(H,17,22)(H,18,21)(H,19,24) |
| InChIKey | MZGHIBJJNVOYBR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|