C14H15ClN4O5 — CID 18097275
N-(4-chloro-3-nitrophenyl)-2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetamide (PubChem CID 18097275) has the molecular formula C14H15ClN4O5 and a molecular weight of 354.75 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 18097275 |
| Molecular Formula | C14H15ClN4O5 |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)acetamide |
| SMILES | CC(C)C1NC(=O)N(CC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C14H15ClN4O5/c1-7(2)12-13(21)18(14(22)17-12)6-11(20)16-8-3-4-9(15)10(5-8)19(23)24/h3-5,7,12H,6H2,1-2H3,(H,16,20)(H,17,22) |
| InChIKey | MBHSWPQHYCBHRN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|