C25H29NO6 — CID 24583945
(E)-3-(3,5-dimethoxyphenyl)-1-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one (PubChem CID 24583945) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-1-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-1-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 24583945 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-1-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CC=C(c3c(OC)cc(OC)cc3OC)CC2)cc(OC)c1 |
| InChI | InChI=1S/C25H29NO6/c1-28-19-12-17(13-20(14-19)29-2)6-7-24(27)26-10-8-18(9-11-26)25-22(31-4)15-21(30-3)16-23(25)32-5/h6-8,12-16H,9-11H2,1-5H3/b7-6+ |
| InChIKey | RMFGGTFNZGDYEE-VOTSOKGWSA-N |
| XLogP | 4.06 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|