C23H31N3O6 — CID 46421297
5,5-diethyl-3-[2-oxo-2-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 46421297) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is 5,5-diethyl-3-[2-oxo-2-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[2-oxo-2-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46421297 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 5,5-diethyl-3-[2-oxo-2-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N2CC=C(c3c(OC)cc(OC)cc3OC)CC2)C1=O |
| InChI | InChI=1S/C23H31N3O6/c1-6-23(7-2)21(28)26(22(29)24-23)14-19(27)25-10-8-15(9-11-25)20-17(31-4)12-16(30-3)13-18(20)32-5/h8,12-13H,6-7,9-11,14H2,1-5H3,(H,24,29) |
| InChIKey | RKLPQARMMUADMJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|