C27H30N2O6 — CID 42281055
5-methyl-2-[4-oxo-4-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 42281055) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 5-methyl-2-[4-oxo-4-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 5-methyl-2-[4-oxo-4-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42281055 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 5-methyl-2-[4-oxo-4-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | COc1cc(OC)c(C2=CCN(C(=O)CCCN3C(=O)c4ccc(C)cc4C3=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H30N2O6/c1-17-7-8-20-21(14-17)27(32)29(26(20)31)11-5-6-24(30)28-12-9-18(10-13-28)25-22(34-3)15-19(33-2)16-23(25)35-4/h7-9,14-16H,5-6,10-13H2,1-4H3 |
| InChIKey | BZHLTXTXXSZNJP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|