C23H19N3O2S — CID 24585487
N-cyclopropyl-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-2-phenylacetamide (PubChem CID 24585487) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-2-phenylacetamide.
| Compound Name | N-cyclopropyl-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 24585487 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-cyclopropyl-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-2-phenylacetamide |
| SMILES | O=C(NC1CC1)C(Sc1nc(-c2ccco2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2S/c27-22(24-16-12-13-16)20(15-7-2-1-3-8-15)29-23-17-9-4-5-10-18(17)25-21(26-23)19-11-6-14-28-19/h1-11,14,16,20H,12-13H2,(H,24,27) |
| InChIKey | MVRZGGSHLUVLSY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |