C19H17Cl3N4O3S — CID 24590879
1-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 24590879) has the molecular formula C19H17Cl3N4O3S and a molecular weight of 487.80 g/mol. Its IUPAC name is 1-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 24590879 |
| Molecular Formula | C19H17Cl3N4O3S |
| Molecular Weight | 487.80 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | 1-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(Cc2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C19H17Cl3N4O3S/c20-12-8-14(22)15(9-13(12)21)28-11-18(27)26-5-3-25(4-6-26)10-17-23-19(24-29-17)16-2-1-7-30-16/h1-2,7-9H,3-6,10-11H2 |
| InChIKey | HJPWRDVVDGMELE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|