C21H18ClN5O2S — CID 55824716
(2-chloroquinolin-6-yl)-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methanone (PubChem CID 55824716) has the molecular formula C21H18ClN5O2S and a molecular weight of 439.93 g/mol. Its IUPAC name is (2-chloroquinolin-6-yl)-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (2-chloroquinolin-6-yl)-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55824716 |
| Molecular Formula | C21H18ClN5O2S |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (2-chloroquinolin-6-yl)-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc(Cl)ccc2c1)N1CCN(Cc2nc(-c3cccs3)no2)CC1 |
| InChI | InChI=1S/C21H18ClN5O2S/c22-18-6-4-14-12-15(3-5-16(14)23-18)21(28)27-9-7-26(8-10-27)13-19-24-20(25-29-19)17-2-1-11-30-17/h1-6,11-12H,7-10,13H2 |
| InChIKey | FAHUPFIHSJMRLJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|