C21H19N5O4S — CID 24610075
2-methyl-5-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 24610075) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-methyl-5-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 24610075 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-methyl-5-[4-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(C(=O)N3CCN(Cc4nc(-c5cccs5)no4)CC3)cc2C1=O |
| InChI | InChI=1S/C21H19N5O4S/c1-24-20(28)14-5-4-13(11-15(14)21(24)29)19(27)26-8-6-25(7-9-26)12-17-22-18(23-30-17)16-3-2-10-31-16/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | ABTYFHVPPCRZFZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|